C34H35N5O5S — CID 71457456
(E)-3-[4-[[1-[[2-(2-acetamido-1,3-thiazol-4-yl)-3-cyclopentyl-1-methylindole-6-carbonyl]amino]cyclobutanecarbonyl]amino]phenyl]prop-2-enoic acid (PubChem CID 71457456) has the molecular formula C34H35N5O5S and a molecular weight of 625.75 g/mol. Its IUPAC name is (E)-3-[4-[[1-[[2-(2-acetamido-1,3-thiazol-4-yl)-3-cyclopentyl-1-methylindole-6-carbonyl]amino]cyclobutanecarbonyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[1-[[2-(2-acetamido-1,3-thiazol-4-yl)-3-cyclopentyl-1-methylindole-6-carbonyl]amino]cyclobutanecarbonyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 71457456 |
| Molecular Formula | C34H35N5O5S |
| Molecular Weight | 625.75 g/mol |
| Exact Mass | 625.24 |
| IUPAC Name | (E)-3-[4-[[1-[[2-(2-acetamido-1,3-thiazol-4-yl)-3-cyclopentyl-1-methylindole-6-carbonyl]amino]cyclobutanecarbonyl]amino]phenyl]prop-2-enoic acid |
| SMILES | CC(=O)Nc1nc(-c2c(C3CCCC3)c3ccc(C(=O)NC4(C(=O)Nc5ccc(/C=C/C(=O)O)cc5)CCC4)cc3n2C)cs1 |
| InChI | InChI=1S/C34H35N5O5S/c1-20(40)35-33-37-26(19-45-33)30-29(22-6-3-4-7-22)25-14-11-23(18-27(25)39(30)2)31(43)38-34(16-5-17-34)32(44)36-24-12-8-21(9-13-24)10-15-28(41)42/h8-15,18-19,22H,3-7,16-17H2,1-2H3,(H,36,44)(H,38,43)(H,41,42)(H,35,37,40)/b15-10+ |
| InChIKey | HRACCWZQDBTBFG-XNTDXEJSSA-N |
| XLogP | 6.31 |
| TPSA | 142.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.75 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|