C34H37N5O4S — CID 71457457
(E)-3-[4-[[1-[[3-cyclopentyl-2-[2-(dimethylamino)-1,3-thiazol-4-yl]-1-methylindole-6-carbonyl]amino]cyclobutanecarbonyl]amino]phenyl]prop-2-enoic acid (PubChem CID 71457457) has the molecular formula C34H37N5O4S and a molecular weight of 611.77 g/mol. Its IUPAC name is (E)-3-[4-[[1-[[3-cyclopentyl-2-[2-(dimethylamino)-1,3-thiazol-4-yl]-1-methylindole-6-carbonyl]amino]cyclobutanecarbonyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[1-[[3-cyclopentyl-2-[2-(dimethylamino)-1,3-thiazol-4-yl]-1-methylindole-6-carbonyl]amino]cyclobutanecarbonyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 71457457 |
| Molecular Formula | C34H37N5O4S |
| Molecular Weight | 611.77 g/mol |
| Exact Mass | 611.26 |
| IUPAC Name | (E)-3-[4-[[1-[[3-cyclopentyl-2-[2-(dimethylamino)-1,3-thiazol-4-yl]-1-methylindole-6-carbonyl]amino]cyclobutanecarbonyl]amino]phenyl]prop-2-enoic acid |
| SMILES | CN(C)c1nc(-c2c(C3CCCC3)c3ccc(C(=O)NC4(C(=O)Nc5ccc(/C=C/C(=O)O)cc5)CCC4)cc3n2C)cs1 |
| InChI | InChI=1S/C34H37N5O4S/c1-38(2)33-36-26(20-44-33)30-29(22-7-4-5-8-22)25-15-12-23(19-27(25)39(30)3)31(42)37-34(17-6-18-34)32(43)35-24-13-9-21(10-14-24)11-16-28(40)41/h9-16,19-20,22H,4-8,17-18H2,1-3H3,(H,35,43)(H,37,42)(H,40,41)/b16-11+ |
| InChIKey | GRBUSGUQRJKIFL-LFIBNONCSA-N |
| XLogP | 6.41 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.77 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|