C35H40N3O10P — CID 71457503
[4-[(E)-1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenyl] [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] hydrogen phosphate (PubChem CID 71457503) has the molecular formula C35H40N3O10P and a molecular weight of 693.69 g/mol. Its IUPAC name is [4-[(E)-1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenyl] [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] hydrogen phosphate.
| Compound Name | [4-[(E)-1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenyl] [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] hydrogen phosphate |
|---|---|
| PubChem CID | 71457503 |
| Molecular Formula | C35H40N3O10P |
| Molecular Weight | 693.69 g/mol |
| Exact Mass | 693.25 |
| IUPAC Name | [4-[(E)-1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-phenylbut-1-enyl]phenyl] [(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] hydrogen phosphate |
| SMILES | CC/C(=C(/c1ccc(OCCN(C)C)cc1)c1ccc(OP(=O)(O)O[C@H]2[C@@H](O)[C@H](n3ccc(=O)[nH]c3=O)O[C@@H]2CO)cc1)c1ccccc1 |
| InChI | InChI=1S/C35H40N3O10P/c1-4-28(23-8-6-5-7-9-23)31(24-10-14-26(15-11-24)45-21-20-37(2)3)25-12-16-27(17-13-25)47-49(43,44)48-33-29(22-39)46-34(32(33)41)38-19-18-30(40)36-35(38)42/h5-19,29,32-34,39,41H,4,20-22H2,1-3H3,(H,43,44)(H,36,40,42)/b31-28+/t29-,32-,33-,34-/m1/s1 |
| InChIKey | ZIMRQKAMSCEBRO-NZIOMIQQSA-N |
| XLogP | 3.66 |
| TPSA | 172.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.69 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|