C13H14BrN3O3 — CID 71457609
(1S,2R,5R)-5-(5-bromo-4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3-(hydroxymethyl)cyclopent-3-ene-1,2-diol (PubChem CID 71457609) has the molecular formula C13H14BrN3O3 and a molecular weight of 340.18 g/mol. Its IUPAC name is (1S,2R,5R)-5-(5-bromo-4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3-(hydroxymethyl)cyclopent-3-ene-1,2-diol.
| Compound Name | (1S,2R,5R)-5-(5-bromo-4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3-(hydroxymethyl)cyclopent-3-ene-1,2-diol |
|---|---|
| PubChem CID | 71457609 |
| Molecular Formula | C13H14BrN3O3 |
| Molecular Weight | 340.18 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | (1S,2R,5R)-5-(5-bromo-4-methylpyrrolo[2,3-d]pyrimidin-7-yl)-3-(hydroxymethyl)cyclopent-3-ene-1,2-diol |
| SMILES | Cc1ncnc2c1c(Br)cn2[C@@H]1C=C(CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H14BrN3O3/c1-6-10-8(14)3-17(13(10)16-5-15-6)9-2-7(4-18)11(19)12(9)20/h2-3,5,9,11-12,18-20H,4H2,1H3/t9-,11-,12+/m1/s1 |
| InChIKey | GLOUGOJSGXIRTG-JLLWLGSASA-N |
| XLogP | 0.70 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.18 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|