C23H27N3O3 — CID 71457755
(1S,2R,4R,11S,12R)-4,8-dimethyl-12-[(4-phenyltriazol-1-yl)methyl]-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one (PubChem CID 71457755) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is (1S,2R,4R,11S,12R)-4,8-dimethyl-12-[(4-phenyltriazol-1-yl)methyl]-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one.
| Compound Name | (1S,2R,4R,11S,12R)-4,8-dimethyl-12-[(4-phenyltriazol-1-yl)methyl]-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one |
|---|---|
| PubChem CID | 71457755 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | (1S,2R,4R,11S,12R)-4,8-dimethyl-12-[(4-phenyltriazol-1-yl)methyl]-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one |
| SMILES | CC1=CCC[C@@]2(C)O[C@@H]2[C@H]2OC(=O)[C@@H](Cn3cc(-c4ccccc4)nn3)[C@@H]2CC1 |
| InChI | InChI=1S/C23H27N3O3/c1-15-7-6-12-23(2)21(29-23)20-17(11-10-15)18(22(27)28-20)13-26-14-19(24-25-26)16-8-4-3-5-9-16/h3-5,7-9,14,17-18,20-21H,6,10-13H2,1-2H3/t17-,18-,20-,21+,23+/m0/s1 |
| InChIKey | QWXIKHODOAZTAO-DUZVJDNUSA-N |
| XLogP | 3.78 |
| TPSA | 69.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|