C19H15N7OS — CID 71457926
2-[(1S)-1-(6-aminopurin-9-yl)ethyl]-3-phenylthieno[3,2-d]pyrimidin-4-one (PubChem CID 71457926) has the molecular formula C19H15N7OS and a molecular weight of 389.44 g/mol. Its IUPAC name is 2-[(1S)-1-(6-aminopurin-9-yl)ethyl]-3-phenylthieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-[(1S)-1-(6-aminopurin-9-yl)ethyl]-3-phenylthieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 71457926 |
| Molecular Formula | C19H15N7OS |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 2-[(1S)-1-(6-aminopurin-9-yl)ethyl]-3-phenylthieno[3,2-d]pyrimidin-4-one |
| SMILES | C[C@@H](c1nc2ccsc2c(=O)n1-c1ccccc1)n1cnc2c(N)ncnc21 |
| InChI | InChI=1S/C19H15N7OS/c1-11(25-10-23-14-16(20)21-9-22-18(14)25)17-24-13-7-8-28-15(13)19(27)26(17)12-5-3-2-4-6-12/h2-11H,1H3,(H2,20,21,22)/t11-/m0/s1 |
| InChIKey | MHPVRYQHDKYIDU-NSHDSACASA-N |
| XLogP | 2.78 |
| TPSA | 104.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |