C11H16N2O6S — CID 71457958
4-[[(2R,3S,4S,5R)-3,4,5-trihydroxyoxan-2-yl]amino]benzenesulfonamide (PubChem CID 71457958) has the molecular formula C11H16N2O6S and a molecular weight of 304.32 g/mol. Its IUPAC name is 4-[[(2R,3S,4S,5R)-3,4,5-trihydroxyoxan-2-yl]amino]benzenesulfonamide.
| Compound Name | 4-[[(2R,3S,4S,5R)-3,4,5-trihydroxyoxan-2-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 71457958 |
| Molecular Formula | C11H16N2O6S |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 4-[[(2R,3S,4S,5R)-3,4,5-trihydroxyoxan-2-yl]amino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(N[C@@H]2OC[C@@H](O)[C@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C11H16N2O6S/c12-20(17,18)7-3-1-6(2-4-7)13-11-10(16)9(15)8(14)5-19-11/h1-4,8-11,13-16H,5H2,(H2,12,17,18)/t8-,9+,10+,11-/m1/s1 |
| InChIKey | FGIKBEHQPSXRFZ-VPOLOUISSA-N |
| XLogP | -1.82 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |