C21H31N3O5 — CID 71458014
(3S)-N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-N',3-dihydroxy-2-[[(2R)-1,2,3,4-tetrahydronaphthalen-2-yl]methyl]butanediamide (PubChem CID 71458014) has the molecular formula C21H31N3O5 and a molecular weight of 405.50 g/mol. Its IUPAC name is (3S)-N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-N',3-dihydroxy-2-[[(2R)-1,2,3,4-tetrahydronaphthalen-2-yl]methyl]butanediamide.
| Compound Name | (3S)-N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-N',3-dihydroxy-2-[[(2R)-1,2,3,4-tetrahydronaphthalen-2-yl]methyl]butanediamide |
|---|---|
| PubChem CID | 71458014 |
| Molecular Formula | C21H31N3O5 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | (3S)-N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-N',3-dihydroxy-2-[[(2R)-1,2,3,4-tetrahydronaphthalen-2-yl]methyl]butanediamide |
| SMILES | CC(C)(C)[C@H](NC(=O)C(C[C@H]1CCc2ccccc2C1)[C@H](O)C(=O)NO)C(N)=O |
| InChI | InChI=1S/C21H31N3O5/c1-21(2,3)17(18(22)26)23-19(27)15(16(25)20(28)24-29)11-12-8-9-13-6-4-5-7-14(13)10-12/h4-7,12,15-17,25,29H,8-11H2,1-3H3,(H2,22,26)(H,23,27)(H,24,28)/t12-,15?,16-,17+/m0/s1 |
| InChIKey | XJXBTXINGWHTHD-RJCAOGMDSA-N |
| XLogP | 0.68 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|