C24H31NO2 — CID 71458025
(9S)-1,13,13-trimethyl-10-[(2S)-2-phenoxypropyl]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-5-ol (PubChem CID 71458025) has the molecular formula C24H31NO2 and a molecular weight of 365.52 g/mol. Its IUPAC name is (9S)-1,13,13-trimethyl-10-[(2S)-2-phenoxypropyl]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-5-ol.
| Compound Name | (9S)-1,13,13-trimethyl-10-[(2S)-2-phenoxypropyl]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-5-ol |
|---|---|
| PubChem CID | 71458025 |
| Molecular Formula | C24H31NO2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | (9S)-1,13,13-trimethyl-10-[(2S)-2-phenoxypropyl]-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-5-ol |
| SMILES | C[C@@H](CN1CCC2(C)c3ccc(O)cc3C[C@H]1C2(C)C)Oc1ccccc1 |
| InChI | InChI=1S/C24H31NO2/c1-17(27-20-8-6-5-7-9-20)16-25-13-12-24(4)21-11-10-19(26)14-18(21)15-22(25)23(24,2)3/h5-11,14,17,22,26H,12-13,15-16H2,1-4H3/t17-,22-,24?/m0/s1 |
| InChIKey | LMKGEGFYXCALHV-LDQFBORQSA-N |
| XLogP | 4.77 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |