C21H28O3 — CID 71458062
(8R,9S,10S,13S,14S)-13-methyl-10-[[(2S)-oxiran-2-yl]methyl]-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 71458062) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is (8R,9S,10S,13S,14S)-13-methyl-10-[[(2S)-oxiran-2-yl]methyl]-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8R,9S,10S,13S,14S)-13-methyl-10-[[(2S)-oxiran-2-yl]methyl]-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 71458062 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | (8R,9S,10S,13S,14S)-13-methyl-10-[[(2S)-oxiran-2-yl]methyl]-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C[C@H]3CO3)[C@@H]1CCC2=O |
| InChI | InChI=1S/C21H28O3/c1-20-8-7-18-16(17(20)4-5-19(20)23)3-2-13-10-14(22)6-9-21(13,18)11-15-12-24-15/h10,15-18H,2-9,11-12H2,1H3/t15-,16-,17-,18-,20-,21+/m0/s1 |
| InChIKey | UJIMEQLZIHUANY-JPRZGNOKSA-N |
| XLogP | 3.86 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|