About 1-methyl-4-[(2S,3S)-3-phenyloxiran-2-yl]sulfonylpiperazine
1-methyl-4-[(2S,3S)-3-phenyloxiran-2-yl]sulfonylpiperazine (PubChem CID 71458078) has the molecular formula C13H18N2O3S
and a molecular weight of 282.36 g/mol. Its IUPAC name is 1-methyl-4-[(2S,3S)-3-phenyloxiran-2-yl]sulfonylpiperazine.
Molecular Properties
| Compound Name | 1-methyl-4-[(2S,3S)-3-phenyloxiran-2-yl]sulfonylpiperazine |
| PubChem CID | 71458078 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 1-methyl-4-[(2S,3S)-3-phenyloxiran-2-yl]sulfonylpiperazine |
| SMILES | CN1CCN(S(=O)(=O)[C@@H]2O[C@H]2c2ccccc2)CC1 |
| InChI | InChI=1S/C13H18N2O3S/c1-14-7-9-15(10-8-14)19(16,17)13-12(18-13)11-5-3-2-4-6-11/h2-6,12-13H,7-10H2,1H3/t12-,13-/m0/s1 |
| InChIKey | XYZKHFFGMOQCLX-STQMWFEESA-N |
| XLogP | 0.66 |
| TPSA | 53.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-[(2S,3S)-3-phenyloxiran-2-yl]sulfonylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-[(2S,3S)-3-phenyloxiran-2-yl]sulfonylpiperazine?
The IUPAC name of 1-methyl-4-[(2S,3S)-3-phenyloxiran-2-yl]sulfonylpiperazine (CID 71458078) is 1-methyl-4-[(2S,3S)-3-phenyloxiran-2-yl]sulfonylpiperazine.
What is the SMILES notation for 1-methyl-4-[(2S,3S)-3-phenyloxiran-2-yl]sulfonylpiperazine?
The canonical SMILES for 1-methyl-4-[(2S,3S)-3-phenyloxiran-2-yl]sulfonylpiperazine is CN1CCN(S(=O)(=O)[C@@H]2O[C@H]2c2ccccc2)CC1.
What is the InChIKey of 1-methyl-4-[(2S,3S)-3-phenyloxiran-2-yl]sulfonylpiperazine?
The InChIKey is XYZKHFFGMOQCLX-STQMWFEESA-N. The full InChI is InChI=1S/C13H18N2O3S/c1-14-7-9-15(10-8-14)19(16,17)13-12(18-13)11-5-3-2-4-6-11/h2-6,12-13H,7-10H2,1H3/t12-,13-/m0/s1.
What are the key properties of 1-methyl-4-[(2S,3S)-3-phenyloxiran-2-yl]sulfonylpiperazine?
1-methyl-4-[(2S,3S)-3-phenyloxiran-2-yl]sulfonylpiperazine has a molecular weight of 282.36 g/mol, XLogP of 0.66, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-[(2S,3S)-3-phenyloxiran-2-yl]sulfonylpiperazine is sourced from PubChem (CID 71458078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).