C28H33NO7 — CID 71458133
[(7S,8R)-7-[(2S)-2-hydroxy-2-phenylbutanoyl]oxy-4-oxido-5,6,7,8-tetrahydro-3H-pyrrolizin-4-ium-1-yl]methyl 2-hydroxy-2-phenylbutanoate (PubChem CID 71458133) has the molecular formula C28H33NO7 and a molecular weight of 495.57 g/mol. Its IUPAC name is [(7S,8R)-7-[(2S)-2-hydroxy-2-phenylbutanoyl]oxy-4-oxido-5,6,7,8-tetrahydro-3H-pyrrolizin-4-ium-1-yl]methyl 2-hydroxy-2-phenylbutanoate.
| Compound Name | [(7S,8R)-7-[(2S)-2-hydroxy-2-phenylbutanoyl]oxy-4-oxido-5,6,7,8-tetrahydro-3H-pyrrolizin-4-ium-1-yl]methyl 2-hydroxy-2-phenylbutanoate |
|---|---|
| PubChem CID | 71458133 |
| Molecular Formula | C28H33NO7 |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | [(7S,8R)-7-[(2S)-2-hydroxy-2-phenylbutanoyl]oxy-4-oxido-5,6,7,8-tetrahydro-3H-pyrrolizin-4-ium-1-yl]methyl 2-hydroxy-2-phenylbutanoate |
| SMILES | CCC(O)(C(=O)OCC1=CC[N+]2([O-])CC[C@H](OC(=O)[C@](O)(CC)c3ccccc3)[C@@H]12)c1ccccc1 |
| InChI | InChI=1S/C28H33NO7/c1-3-27(32,21-11-7-5-8-12-21)25(30)35-19-20-15-17-29(34)18-16-23(24(20)29)36-26(31)28(33,4-2)22-13-9-6-10-14-22/h5-15,23-24,32-33H,3-4,16-19H2,1-2H3/t23-,24+,27?,28-,29?/m0/s1 |
| InChIKey | SPSDRMFMSHXJGD-IRNGFQEPSA-N |
| XLogP | 3.06 |
| TPSA | 116.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|