C33H48BrNO5 — CID 71458170
(4,5-dihydroxy-7-methoxy-9,10-dioxoanthracen-2-yl)methyl-methyl-dioctylazanium bromide (PubChem CID 71458170) has the molecular formula C33H48BrNO5 and a molecular weight of 618.65 g/mol. Its IUPAC name is (4,5-dihydroxy-7-methoxy-9,10-dioxoanthracen-2-yl)methyl-methyl-dioctylazanium bromide.
| Compound Name | (4,5-dihydroxy-7-methoxy-9,10-dioxoanthracen-2-yl)methyl-methyl-dioctylazanium bromide |
|---|---|
| PubChem CID | 71458170 |
| Molecular Formula | C33H48BrNO5 |
| Molecular Weight | 618.65 g/mol |
| Exact Mass | 617.27 |
| IUPAC Name | (4,5-dihydroxy-7-methoxy-9,10-dioxoanthracen-2-yl)methyl-methyl-dioctylazanium bromide |
| SMILES | CCCCCCCC[N+](C)(CCCCCCCC)Cc1cc(O)c2c(c1)C(=O)c1cc(OC)cc(O)c1C2=O.[Br-] |
| InChI | InChI=1S/C33H47NO5.BrH/c1-5-7-9-11-13-15-17-34(3,18-16-14-12-10-8-6-2)23-24-19-26-30(28(35)20-24)33(38)31-27(32(26)37)21-25(39-4)22-29(31)36;/h19-22H,5-18,23H2,1-4H3,(H-,35,36,38);1H |
| InChIKey | FPPYDOXFPUIVAZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.65 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|