C14H13NO2S — CID 71458307
methyl (2Z,4E)-5-phenyl-2-(thiocyanatomethyl)penta-2,4-dienoate (PubChem CID 71458307) has the molecular formula C14H13NO2S and a molecular weight of 259.33 g/mol. Its IUPAC name is methyl (2Z,4E)-5-phenyl-2-(thiocyanatomethyl)penta-2,4-dienoate.
| Compound Name | methyl (2Z,4E)-5-phenyl-2-(thiocyanatomethyl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 71458307 |
| Molecular Formula | C14H13NO2S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | methyl (2Z,4E)-5-phenyl-2-(thiocyanatomethyl)penta-2,4-dienoate |
| SMILES | COC(=O)/C(=C/C=C/c1ccccc1)CSC#N |
| InChI | InChI=1S/C14H13NO2S/c1-17-14(16)13(10-18-11-15)9-5-8-12-6-3-2-4-7-12/h2-9H,10H2,1H3/b8-5+,13-9+ |
| InChIKey | KTNCSQXRLHHXHK-BHHNFLQBSA-N |
| XLogP | 3.01 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|