C22H23N5O2S — CID 71458364
6-(1-benzyl-5-methyltriazol-4-yl)-4-(2,4-dimethoxyphenyl)-3,4-dihydro-1H-pyrimidine-2-thione (PubChem CID 71458364) has the molecular formula C22H23N5O2S and a molecular weight of 421.53 g/mol. Its IUPAC name is 6-(1-benzyl-5-methyltriazol-4-yl)-4-(2,4-dimethoxyphenyl)-3,4-dihydro-1H-pyrimidine-2-thione.
| Compound Name | 6-(1-benzyl-5-methyltriazol-4-yl)-4-(2,4-dimethoxyphenyl)-3,4-dihydro-1H-pyrimidine-2-thione |
|---|---|
| PubChem CID | 71458364 |
| Molecular Formula | C22H23N5O2S |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 6-(1-benzyl-5-methyltriazol-4-yl)-4-(2,4-dimethoxyphenyl)-3,4-dihydro-1H-pyrimidine-2-thione |
| SMILES | COc1ccc(C2C=C(c3nnn(Cc4ccccc4)c3C)NC(=S)N2)c(OC)c1 |
| InChI | InChI=1S/C22H23N5O2S/c1-14-21(25-26-27(14)13-15-7-5-4-6-8-15)19-12-18(23-22(30)24-19)17-10-9-16(28-2)11-20(17)29-3/h4-12,18H,13H2,1-3H3,(H2,23,24,30) |
| InChIKey | RDJUSXQMLLJWLH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 73.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|