C25H28INO4 — CID 71458397
dimethyl (2R,3S,3aS,4S,7R,7aR)-7-iodo-1-(4-methylphenyl)-2-phenyl-2,3,3a,4,5,6,7,7a-octahydroindole-3,4-dicarboxylate (PubChem CID 71458397) has the molecular formula C25H28INO4 and a molecular weight of 533.41 g/mol. Its IUPAC name is dimethyl (2R,3S,3aS,4S,7R,7aR)-7-iodo-1-(4-methylphenyl)-2-phenyl-2,3,3a,4,5,6,7,7a-octahydroindole-3,4-dicarboxylate.
| Compound Name | dimethyl (2R,3S,3aS,4S,7R,7aR)-7-iodo-1-(4-methylphenyl)-2-phenyl-2,3,3a,4,5,6,7,7a-octahydroindole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 71458397 |
| Molecular Formula | C25H28INO4 |
| Molecular Weight | 533.41 g/mol |
| Exact Mass | 533.11 |
| IUPAC Name | dimethyl (2R,3S,3aS,4S,7R,7aR)-7-iodo-1-(4-methylphenyl)-2-phenyl-2,3,3a,4,5,6,7,7a-octahydroindole-3,4-dicarboxylate |
| SMILES | COC(=O)[C@H]1[C@H]2[C@H]([C@H](I)CC[C@@H]2C(=O)OC)N(c2ccc(C)cc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C25H28INO4/c1-15-9-11-17(12-10-15)27-22(16-7-5-4-6-8-16)21(25(29)31-3)20-18(24(28)30-2)13-14-19(26)23(20)27/h4-12,18-23H,13-14H2,1-3H3/t18-,19+,20-,21-,22-,23-/m0/s1 |
| InChIKey | GIVWONDWHDRLQZ-ZKPZVSKHSA-N |
| XLogP | 4.72 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.41 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|