C21H34O11 — CID 71458434
(2R,3R,4S,5S,6R)-2-[[(3S,3aR,6aS)-3,6-dimethyl-2,3,3a,4-tetrahydrocyclopenta[b]furan-6a-yl]methoxy]-6-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]oxane-3,4,5-triol (PubChem CID 71458434) has the molecular formula C21H34O11 and a molecular weight of 462.49 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[[(3S,3aR,6aS)-3,6-dimethyl-2,3,3a,4-tetrahydrocyclopenta[b]furan-6a-yl]methoxy]-6-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[[(3S,3aR,6aS)-3,6-dimethyl-2,3,3a,4-tetrahydrocyclopenta[b]furan-6a-yl]methoxy]-6-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 71458434 |
| Molecular Formula | C21H34O11 |
| Molecular Weight | 462.49 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[[(3S,3aR,6aS)-3,6-dimethyl-2,3,3a,4-tetrahydrocyclopenta[b]furan-6a-yl]methoxy]-6-[[(2R,3R,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]oxane-3,4,5-triol |
| SMILES | CC1=CC[C@@H]2[C@H](C)CO[C@]12CO[C@@H]1O[C@H](CO[C@@H]2OC[C@](O)(CO)[C@H]2O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C21H34O11/c1-10-5-31-21(11(2)3-4-12(10)21)9-30-18-16(25)15(24)14(23)13(32-18)6-28-19-17(26)20(27,7-22)8-29-19/h3,10,12-19,22-27H,4-9H2,1-2H3/t10-,12-,13-,14-,15+,16-,17+,18-,19-,20-,21-/m1/s1 |
| InChIKey | RKKLMLPXHGWOKI-FXHXVMKNSA-N |
| XLogP | -2.36 |
| TPSA | 167.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.49 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|