C10H16O3 — CID 71458435
(4R,4aS,7R,7aR)-7-hydroxy-4,7-dimethyl-1,4,4a,5,6,7a-hexahydrocyclopenta[c]pyran-3-one (PubChem CID 71458435) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is (4R,4aS,7R,7aR)-7-hydroxy-4,7-dimethyl-1,4,4a,5,6,7a-hexahydrocyclopenta[c]pyran-3-one.
| Compound Name | (4R,4aS,7R,7aR)-7-hydroxy-4,7-dimethyl-1,4,4a,5,6,7a-hexahydrocyclopenta[c]pyran-3-one |
|---|---|
| PubChem CID | 71458435 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | (4R,4aS,7R,7aR)-7-hydroxy-4,7-dimethyl-1,4,4a,5,6,7a-hexahydrocyclopenta[c]pyran-3-one |
| SMILES | C[C@H]1C(=O)OC[C@H]2[C@@H]1CC[C@@]2(C)O |
| InChI | InChI=1S/C10H16O3/c1-6-7-3-4-10(2,12)8(7)5-13-9(6)11/h6-8,12H,3-5H2,1-2H3/t6-,7-,8+,10-/m1/s1 |
| InChIKey | KCIYXMDQXNFJBA-BDNRQGISSA-N |
| XLogP | 0.96 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |