C21H31NO2 — CID 71458441
1-[(6aS,10aS)-3-hydroxy-7,7,10a-trimethyl-4-propan-2-yl-6a,8,9,10-tetrahydro-6H-phenanthridin-5-yl]ethanone (PubChem CID 71458441) has the molecular formula C21H31NO2 and a molecular weight of 329.48 g/mol. Its IUPAC name is 1-[(6aS,10aS)-3-hydroxy-7,7,10a-trimethyl-4-propan-2-yl-6a,8,9,10-tetrahydro-6H-phenanthridin-5-yl]ethanone.
| Compound Name | 1-[(6aS,10aS)-3-hydroxy-7,7,10a-trimethyl-4-propan-2-yl-6a,8,9,10-tetrahydro-6H-phenanthridin-5-yl]ethanone |
|---|---|
| PubChem CID | 71458441 |
| Molecular Formula | C21H31NO2 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | 1-[(6aS,10aS)-3-hydroxy-7,7,10a-trimethyl-4-propan-2-yl-6a,8,9,10-tetrahydro-6H-phenanthridin-5-yl]ethanone |
| SMILES | CC(=O)N1C[C@H]2C(C)(C)CCC[C@]2(C)c2ccc(O)c(C(C)C)c21 |
| InChI | InChI=1S/C21H31NO2/c1-13(2)18-16(24)9-8-15-19(18)22(14(3)23)12-17-20(4,5)10-7-11-21(15,17)6/h8-9,13,17,24H,7,10-12H2,1-6H3/t17-,21+/m0/s1 |
| InChIKey | LXZCJNAWQZQRDR-LAUBAEHRSA-N |
| XLogP | 4.97 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |