About [(2R,6S)-6-naphthalen-2-yloxan-2-yl]methanol
[(2R,6S)-6-naphthalen-2-yloxan-2-yl]methanol (PubChem CID 71458452) has the molecular formula C16H18O2
and a molecular weight of 242.32 g/mol. Its IUPAC name is [(2R,6S)-6-naphthalen-2-yloxan-2-yl]methanol.
Molecular Properties
| Compound Name | [(2R,6S)-6-naphthalen-2-yloxan-2-yl]methanol |
| PubChem CID | 71458452 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | [(2R,6S)-6-naphthalen-2-yloxan-2-yl]methanol |
| SMILES | OC[C@H]1CCC[C@@H](c2ccc3ccccc3c2)O1 |
| InChI | InChI=1S/C16H18O2/c17-11-15-6-3-7-16(18-15)14-9-8-12-4-1-2-5-13(12)10-14/h1-2,4-5,8-10,15-17H,3,6-7,11H2/t15-,16+/m1/s1 |
| InChIKey | ROSNKONMNKJRBC-CVEARBPZSA-N |
| XLogP | 3.44 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(2R,6S)-6-naphthalen-2-yloxan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,6S)-6-naphthalen-2-yloxan-2-yl]methanol?
The IUPAC name of [(2R,6S)-6-naphthalen-2-yloxan-2-yl]methanol (CID 71458452) is [(2R,6S)-6-naphthalen-2-yloxan-2-yl]methanol.
What is the SMILES notation for [(2R,6S)-6-naphthalen-2-yloxan-2-yl]methanol?
The canonical SMILES for [(2R,6S)-6-naphthalen-2-yloxan-2-yl]methanol is OC[C@H]1CCC[C@@H](c2ccc3ccccc3c2)O1.
What is the InChIKey of [(2R,6S)-6-naphthalen-2-yloxan-2-yl]methanol?
The InChIKey is ROSNKONMNKJRBC-CVEARBPZSA-N. The full InChI is InChI=1S/C16H18O2/c17-11-15-6-3-7-16(18-15)14-9-8-12-4-1-2-5-13(12)10-14/h1-2,4-5,8-10,15-17H,3,6-7,11H2/t15-,16+/m1/s1.
What are the key properties of [(2R,6S)-6-naphthalen-2-yloxan-2-yl]methanol?
[(2R,6S)-6-naphthalen-2-yloxan-2-yl]methanol has a molecular weight of 242.32 g/mol, XLogP of 3.44, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,6S)-6-naphthalen-2-yloxan-2-yl]methanol is sourced from PubChem (CID 71458452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).