C26H22F2N2O4 — CID 71458474
2-[(E)-3-(4-fluoro-3-methoxyphenyl)-2-(4-fluorophenyl)prop-2-enoyl]-N-hydroxy-3,4-dihydro-1H-isoquinoline-7-carboxamide (PubChem CID 71458474) has the molecular formula C26H22F2N2O4 and a molecular weight of 464.47 g/mol. Its IUPAC name is 2-[(E)-3-(4-fluoro-3-methoxyphenyl)-2-(4-fluorophenyl)prop-2-enoyl]-N-hydroxy-3,4-dihydro-1H-isoquinoline-7-carboxamide.
| Compound Name | 2-[(E)-3-(4-fluoro-3-methoxyphenyl)-2-(4-fluorophenyl)prop-2-enoyl]-N-hydroxy-3,4-dihydro-1H-isoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 71458474 |
| Molecular Formula | C26H22F2N2O4 |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 2-[(E)-3-(4-fluoro-3-methoxyphenyl)-2-(4-fluorophenyl)prop-2-enoyl]-N-hydroxy-3,4-dihydro-1H-isoquinoline-7-carboxamide |
| SMILES | COc1cc(/C=C(/C(=O)N2CCc3ccc(C(=O)NO)cc3C2)c2ccc(F)cc2)ccc1F |
| InChI | InChI=1S/C26H22F2N2O4/c1-34-24-13-16(2-9-23(24)28)12-22(18-5-7-21(27)8-6-18)26(32)30-11-10-17-3-4-19(25(31)29-33)14-20(17)15-30/h2-9,12-14,33H,10-11,15H2,1H3,(H,29,31)/b22-12+ |
| InChIKey | UGXPRBJFCBDVJS-WSDLNYQXSA-N |
| XLogP | 4.22 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|