C25H21N3O — CID 71458520
4-isoquinolin-3-yl-10,10-dimethyl-11-oxa-3,5-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),13,15-hexaene (PubChem CID 71458520) has the molecular formula C25H21N3O and a molecular weight of 379.46 g/mol. Its IUPAC name is 4-isoquinolin-3-yl-10,10-dimethyl-11-oxa-3,5-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),13,15-hexaene.
| Compound Name | 4-isoquinolin-3-yl-10,10-dimethyl-11-oxa-3,5-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),13,15-hexaene |
|---|---|
| PubChem CID | 71458520 |
| Molecular Formula | C25H21N3O |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 4-isoquinolin-3-yl-10,10-dimethyl-11-oxa-3,5-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),13,15-hexaene |
| SMILES | CC1(C)CCc2c(c3ccccc3c3[nH]c(-c4cc5ccccc5cn4)nc23)O1 |
| InChI | InChI=1S/C25H21N3O/c1-25(2)12-11-19-22-21(17-9-5-6-10-18(17)23(19)29-25)27-24(28-22)20-13-15-7-3-4-8-16(15)14-26-20/h3-10,13-14H,11-12H2,1-2H3,(H,27,28) |
| InChIKey | JXEGUUDANSPKEK-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |