C31H37N5O2S — CID 71458521
2-[ethyl-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butyl]amino]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 71458521) has the molecular formula C31H37N5O2S and a molecular weight of 543.74 g/mol. Its IUPAC name is 2-[ethyl-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butyl]amino]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-[ethyl-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butyl]amino]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 71458521 |
| Molecular Formula | C31H37N5O2S |
| Molecular Weight | 543.74 g/mol |
| Exact Mass | 543.27 |
| IUPAC Name | 2-[ethyl-[4-(1,2,3,4-tetrahydroacridin-9-ylamino)butyl]amino]-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | CCN(CCCCNc1c2c(nc3ccccc13)CCCC2)CC(=O)Nc1nc(-c2ccc(OC)cc2)cs1 |
| InChI | InChI=1S/C31H37N5O2S/c1-3-36(20-29(37)35-31-34-28(21-39-31)22-14-16-23(38-2)17-15-22)19-9-8-18-32-30-24-10-4-6-12-26(24)33-27-13-7-5-11-25(27)30/h4,6,10,12,14-17,21H,3,5,7-9,11,13,18-20H2,1-2H3,(H,32,33)(H,34,35,37) |
| InChIKey | SURKRFGZUPRRDN-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.74 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|