C24H23N7O3S — CID 71458573
1-methyl-3-[4-[4-[2-[3-(methylsulfamoyl)anilino]pyrimidin-4-yl]-2-pyridinyl]phenyl]urea (PubChem CID 71458573) has the molecular formula C24H23N7O3S and a molecular weight of 489.56 g/mol. Its IUPAC name is 1-methyl-3-[4-[4-[2-[3-(methylsulfamoyl)anilino]pyrimidin-4-yl]-2-pyridinyl]phenyl]urea.
| Compound Name | 1-methyl-3-[4-[4-[2-[3-(methylsulfamoyl)anilino]pyrimidin-4-yl]-2-pyridinyl]phenyl]urea |
|---|---|
| PubChem CID | 71458573 |
| Molecular Formula | C24H23N7O3S |
| Molecular Weight | 489.56 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | 1-methyl-3-[4-[4-[2-[3-(methylsulfamoyl)anilino]pyrimidin-4-yl]-2-pyridinyl]phenyl]urea |
| SMILES | CNC(=O)Nc1ccc(-c2cc(-c3ccnc(Nc4cccc(S(=O)(=O)NC)c4)n3)ccn2)cc1 |
| InChI | InChI=1S/C24H23N7O3S/c1-25-24(32)30-18-8-6-16(7-9-18)22-14-17(10-12-27-22)21-11-13-28-23(31-21)29-19-4-3-5-20(15-19)35(33,34)26-2/h3-15,26H,1-2H3,(H2,25,30,32)(H,28,29,31) |
| InChIKey | NWQHTOFIQMYFRC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 138.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.56 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |