About (2R,6S)-2,6-diphenyl-N-phenylmethoxy-1-prop-2-enylpiperidin-4-imine
(2R,6S)-2,6-diphenyl-N-phenylmethoxy-1-prop-2-enylpiperidin-4-imine (PubChem CID 71458655) has the molecular formula C27H28N2O
and a molecular weight of 396.53 g/mol. Its IUPAC name is (2R,6S)-2,6-diphenyl-N-phenylmethoxy-1-prop-2-enylpiperidin-4-imine.
Molecular Properties
| Compound Name | (2R,6S)-2,6-diphenyl-N-phenylmethoxy-1-prop-2-enylpiperidin-4-imine |
| PubChem CID | 71458655 |
| Molecular Formula | C27H28N2O |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | (2R,6S)-2,6-diphenyl-N-phenylmethoxy-1-prop-2-enylpiperidin-4-imine |
| SMILES | C=CCN1[C@@H](c2ccccc2)C/C(=N/OCc2ccccc2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C27H28N2O/c1-2-18-29-26(23-14-8-4-9-15-23)19-25(20-27(29)24-16-10-5-11-17-24)28-30-21-22-12-6-3-7-13-22/h2-17,26-27H,1,18-21H2/b28-25-/t26-,27+/m1/s1 |
| InChIKey | YKBYDXKDAXFCTR-QPVQHMNXSA-N |
| XLogP | 6.32 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R,6S)-2,6-diphenyl-N-phenylmethoxy-1-prop-2-enylpiperidin-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,6S)-2,6-diphenyl-N-phenylmethoxy-1-prop-2-enylpiperidin-4-imine?
The IUPAC name of (2R,6S)-2,6-diphenyl-N-phenylmethoxy-1-prop-2-enylpiperidin-4-imine (CID 71458655) is (2R,6S)-2,6-diphenyl-N-phenylmethoxy-1-prop-2-enylpiperidin-4-imine.
What is the SMILES notation for (2R,6S)-2,6-diphenyl-N-phenylmethoxy-1-prop-2-enylpiperidin-4-imine?
The canonical SMILES for (2R,6S)-2,6-diphenyl-N-phenylmethoxy-1-prop-2-enylpiperidin-4-imine is C=CCN1[C@@H](c2ccccc2)C/C(=N/OCc2ccccc2)C[C@H]1c1ccccc1.
What is the InChIKey of (2R,6S)-2,6-diphenyl-N-phenylmethoxy-1-prop-2-enylpiperidin-4-imine?
The InChIKey is YKBYDXKDAXFCTR-QPVQHMNXSA-N. The full InChI is InChI=1S/C27H28N2O/c1-2-18-29-26(23-14-8-4-9-15-23)19-25(20-27(29)24-16-10-5-11-17-24)28-30-21-22-12-6-3-7-13-22/h2-17,26-27H,1,18-21H2/b28-25-/t26-,27+/m1/s1.
What are the key properties of (2R,6S)-2,6-diphenyl-N-phenylmethoxy-1-prop-2-enylpiperidin-4-imine?
(2R,6S)-2,6-diphenyl-N-phenylmethoxy-1-prop-2-enylpiperidin-4-imine has a molecular weight of 396.53 g/mol, XLogP of 6.32, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,6S)-2,6-diphenyl-N-phenylmethoxy-1-prop-2-enylpiperidin-4-imine is sourced from PubChem (CID 71458655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).