C14H18N4O4S — CID 71458748
N-hydroxy-2-methyl-2-methylsulfonyl-4-(3-phenyl-1H-1,2,4-triazol-5-yl)butanamide (PubChem CID 71458748) has the molecular formula C14H18N4O4S and a molecular weight of 338.39 g/mol. Its IUPAC name is N-hydroxy-2-methyl-2-methylsulfonyl-4-(3-phenyl-1H-1,2,4-triazol-5-yl)butanamide.
| Compound Name | N-hydroxy-2-methyl-2-methylsulfonyl-4-(3-phenyl-1H-1,2,4-triazol-5-yl)butanamide |
|---|---|
| PubChem CID | 71458748 |
| Molecular Formula | C14H18N4O4S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | N-hydroxy-2-methyl-2-methylsulfonyl-4-(3-phenyl-1H-1,2,4-triazol-5-yl)butanamide |
| SMILES | CC(CCc1nc(-c2ccccc2)n[nH]1)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C14H18N4O4S/c1-14(13(19)18-20,23(2,21)22)9-8-11-15-12(17-16-11)10-6-4-3-5-7-10/h3-7,20H,8-9H2,1-2H3,(H,18,19)(H,15,16,17) |
| InChIKey | IHXXBLQXHJHYKZ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|