C18H12O5 — CID 71458783
(3S)-3,6,7-trihydroxy-3-methylbenzo[a]fluorene-4,11-dione (PubChem CID 71458783) has the molecular formula C18H12O5 and a molecular weight of 308.29 g/mol. Its IUPAC name is (3S)-3,6,7-trihydroxy-3-methylbenzo[a]fluorene-4,11-dione.
| Compound Name | (3S)-3,6,7-trihydroxy-3-methylbenzo[a]fluorene-4,11-dione |
|---|---|
| PubChem CID | 71458783 |
| Molecular Formula | C18H12O5 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | (3S)-3,6,7-trihydroxy-3-methylbenzo[a]fluorene-4,11-dione |
| SMILES | C[C@]1(O)C=Cc2c(cc(O)c3c2C(=O)c2cccc(O)c2-3)C1=O |
| InChI | InChI=1S/C18H12O5/c1-18(23)6-5-8-10(17(18)22)7-12(20)15-13-9(16(21)14(8)15)3-2-4-11(13)19/h2-7,19-20,23H,1H3/t18-/m0/s1 |
| InChIKey | CKTLJJYDUPSLCZ-SFHVURJKSA-N |
| XLogP | 2.27 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |