About 3-[(7-ethynyl-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid
3-[(7-ethynyl-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid (PubChem CID 71458937) has the molecular formula C18H15NO4S
and a molecular weight of 341.39 g/mol. Its IUPAC name is 3-[(7-ethynyl-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid.
Molecular Properties
| Compound Name | 3-[(7-ethynyl-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid |
| PubChem CID | 71458937 |
| Molecular Formula | C18H15NO4S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 3-[(7-ethynyl-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid |
| SMILES | C#Cc1ccc2c(c1)CN(S(=O)(=O)c1cccc(C(=O)O)c1)CC2 |
| InChI | InChI=1S/C18H15NO4S/c1-2-13-6-7-14-8-9-19(12-16(14)10-13)24(22,23)17-5-3-4-15(11-17)18(20)21/h1,3-7,10-11H,8-9,12H2,(H,20,21) |
| InChIKey | DTKGFUCTXXESLR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(7-ethynyl-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(7-ethynyl-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid?
The IUPAC name of 3-[(7-ethynyl-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid (CID 71458937) is 3-[(7-ethynyl-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid.
What is the SMILES notation for 3-[(7-ethynyl-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid?
The canonical SMILES for 3-[(7-ethynyl-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid is C#Cc1ccc2c(c1)CN(S(=O)(=O)c1cccc(C(=O)O)c1)CC2.
What is the InChIKey of 3-[(7-ethynyl-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid?
The InChIKey is DTKGFUCTXXESLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO4S/c1-2-13-6-7-14-8-9-19(12-16(14)10-13)24(22,23)17-5-3-4-15(11-17)18(20)21/h1,3-7,10-11H,8-9,12H2,(H,20,21).
What are the key properties of 3-[(7-ethynyl-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid?
3-[(7-ethynyl-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid has a molecular weight of 341.39 g/mol, XLogP of 2.11, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(7-ethynyl-3,4-dihydro-1H-isoquinolin-2-yl)sulfonyl]benzoic acid is sourced from PubChem (CID 71458937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).