About [2-[tert-butyl(diphenyl)silyl]oxy-2-methoxyethyl] N-octylcarbamate
[2-[tert-butyl(diphenyl)silyl]oxy-2-methoxyethyl] N-octylcarbamate (PubChem CID 71458951) has the molecular formula C28H43NO4Si
and a molecular weight of 485.74 g/mol. Its IUPAC name is [2-[tert-butyl(diphenyl)silyl]oxy-2-methoxyethyl] N-octylcarbamate.
Molecular Properties
| Compound Name | [2-[tert-butyl(diphenyl)silyl]oxy-2-methoxyethyl] N-octylcarbamate |
| PubChem CID | 71458951 |
| Molecular Formula | C28H43NO4Si |
| Molecular Weight | 485.74 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | [2-[tert-butyl(diphenyl)silyl]oxy-2-methoxyethyl] N-octylcarbamate |
| SMILES | CCCCCCCCNC(=O)OCC(OC)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H43NO4Si/c1-6-7-8-9-10-17-22-29-27(30)32-23-26(31-5)33-34(28(2,3)4,24-18-13-11-14-19-24)25-20-15-12-16-21-25/h11-16,18-21,26H,6-10,17,22-23H2,1-5H3,(H,29,30) |
| InChIKey | FAQROORDHIPZBC-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.74 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [2-[tert-butyl(diphenyl)silyl]oxy-2-methoxyethyl] N-octylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[tert-butyl(diphenyl)silyl]oxy-2-methoxyethyl] N-octylcarbamate?
The IUPAC name of [2-[tert-butyl(diphenyl)silyl]oxy-2-methoxyethyl] N-octylcarbamate (CID 71458951) is [2-[tert-butyl(diphenyl)silyl]oxy-2-methoxyethyl] N-octylcarbamate.
What is the SMILES notation for [2-[tert-butyl(diphenyl)silyl]oxy-2-methoxyethyl] N-octylcarbamate?
The canonical SMILES for [2-[tert-butyl(diphenyl)silyl]oxy-2-methoxyethyl] N-octylcarbamate is CCCCCCCCNC(=O)OCC(OC)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C.
What is the InChIKey of [2-[tert-butyl(diphenyl)silyl]oxy-2-methoxyethyl] N-octylcarbamate?
The InChIKey is FAQROORDHIPZBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H43NO4Si/c1-6-7-8-9-10-17-22-29-27(30)32-23-26(31-5)33-34(28(2,3)4,24-18-13-11-14-19-24)25-20-15-12-16-21-25/h11-16,18-21,26H,6-10,17,22-23H2,1-5H3,(H,29,30).
What are the key properties of [2-[tert-butyl(diphenyl)silyl]oxy-2-methoxyethyl] N-octylcarbamate?
[2-[tert-butyl(diphenyl)silyl]oxy-2-methoxyethyl] N-octylcarbamate has a molecular weight of 485.74 g/mol, XLogP of 5.62, 14 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[tert-butyl(diphenyl)silyl]oxy-2-methoxyethyl] N-octylcarbamate is sourced from PubChem (CID 71458951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).