About 5-[(1R,5S)-3-azabicyclo[3.3.1]non-6-en-7-yl]pyridine-3-carbonitrile
5-[(1R,5S)-3-azabicyclo[3.3.1]non-6-en-7-yl]pyridine-3-carbonitrile (PubChem CID 71459035) has the molecular formula C14H15N3
and a molecular weight of 225.30 g/mol. Its IUPAC name is 5-[(1R,5S)-3-azabicyclo[3.3.1]non-6-en-7-yl]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 5-[(1R,5S)-3-azabicyclo[3.3.1]non-6-en-7-yl]pyridine-3-carbonitrile |
| PubChem CID | 71459035 |
| Molecular Formula | C14H15N3 |
| Molecular Weight | 225.30 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 5-[(1R,5S)-3-azabicyclo[3.3.1]non-6-en-7-yl]pyridine-3-carbonitrile |
| SMILES | N#Cc1cncc(C2=C[C@H]3CNC[C@@H](C2)C3)c1 |
| InChI | InChI=1S/C14H15N3/c15-5-12-4-14(9-17-8-12)13-2-10-1-11(3-13)7-16-6-10/h2,4,8-11,16H,1,3,6-7H2/t10-,11+/m0/s1 |
| InChIKey | DEXLAAAKAUMETM-WDEREUQCSA-N |
| XLogP | 1.97 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(1R,5S)-3-azabicyclo[3.3.1]non-6-en-7-yl]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1R,5S)-3-azabicyclo[3.3.1]non-6-en-7-yl]pyridine-3-carbonitrile?
The IUPAC name of 5-[(1R,5S)-3-azabicyclo[3.3.1]non-6-en-7-yl]pyridine-3-carbonitrile (CID 71459035) is 5-[(1R,5S)-3-azabicyclo[3.3.1]non-6-en-7-yl]pyridine-3-carbonitrile.
What is the SMILES notation for 5-[(1R,5S)-3-azabicyclo[3.3.1]non-6-en-7-yl]pyridine-3-carbonitrile?
The canonical SMILES for 5-[(1R,5S)-3-azabicyclo[3.3.1]non-6-en-7-yl]pyridine-3-carbonitrile is N#Cc1cncc(C2=C[C@H]3CNC[C@@H](C2)C3)c1.
What is the InChIKey of 5-[(1R,5S)-3-azabicyclo[3.3.1]non-6-en-7-yl]pyridine-3-carbonitrile?
The InChIKey is DEXLAAAKAUMETM-WDEREUQCSA-N. The full InChI is InChI=1S/C14H15N3/c15-5-12-4-14(9-17-8-12)13-2-10-1-11(3-13)7-16-6-10/h2,4,8-11,16H,1,3,6-7H2/t10-,11+/m0/s1.
What are the key properties of 5-[(1R,5S)-3-azabicyclo[3.3.1]non-6-en-7-yl]pyridine-3-carbonitrile?
5-[(1R,5S)-3-azabicyclo[3.3.1]non-6-en-7-yl]pyridine-3-carbonitrile has a molecular weight of 225.30 g/mol, XLogP of 1.97, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1R,5S)-3-azabicyclo[3.3.1]non-6-en-7-yl]pyridine-3-carbonitrile is sourced from PubChem (CID 71459035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).