C23H24Cl2N4O4 — CID 71459037
N-[N'-[(3,5-dichloro-4-propoxyphenyl)methyl]carbamimidoyl]-3-(4-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 71459037) has the molecular formula C23H24Cl2N4O4 and a molecular weight of 491.38 g/mol. Its IUPAC name is N-[N'-[(3,5-dichloro-4-propoxyphenyl)methyl]carbamimidoyl]-3-(4-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[N'-[(3,5-dichloro-4-propoxyphenyl)methyl]carbamimidoyl]-3-(4-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 71459037 |
| Molecular Formula | C23H24Cl2N4O4 |
| Molecular Weight | 491.38 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | N-[N'-[(3,5-dichloro-4-propoxyphenyl)methyl]carbamimidoyl]-3-(4-methoxyphenyl)-5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | CCCOc1c(Cl)cc(C/N=C(\N)NC(=O)c2c(-c3ccc(OC)cc3)noc2C)cc1Cl |
| InChI | InChI=1S/C23H24Cl2N4O4/c1-4-9-32-21-17(24)10-14(11-18(21)25)12-27-23(26)28-22(30)19-13(2)33-29-20(19)15-5-7-16(31-3)8-6-15/h5-8,10-11H,4,9,12H2,1-3H3,(H3,26,27,28,30) |
| InChIKey | VJDZPEGKZDVQDE-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.38 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|