C33H39F3N4O5 — CID 71459093
2-[4-[[3-[4-(3-aminopropylamino)butylamino]propylamino]methyl]phenoxy]anthracene-1,4-dione;2,2,2-trifluoroacetic acid (PubChem CID 71459093) has the molecular formula C33H39F3N4O5 and a molecular weight of 628.69 g/mol. Its IUPAC name is 2-[4-[[3-[4-(3-aminopropylamino)butylamino]propylamino]methyl]phenoxy]anthracene-1,4-dione;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[4-[[3-[4-(3-aminopropylamino)butylamino]propylamino]methyl]phenoxy]anthracene-1,4-dione;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 71459093 |
| Molecular Formula | C33H39F3N4O5 |
| Molecular Weight | 628.69 g/mol |
| Exact Mass | 628.29 |
| IUPAC Name | 2-[4-[[3-[4-(3-aminopropylamino)butylamino]propylamino]methyl]phenoxy]anthracene-1,4-dione;2,2,2-trifluoroacetic acid |
| SMILES | NCCCNCCCCNCCCNCc1ccc(OC2=CC(=O)c3cc4ccccc4cc3C2=O)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C31H38N4O3.C2HF3O2/c32-13-5-16-33-14-3-4-15-34-17-6-18-35-22-23-9-11-26(12-10-23)38-30-21-29(36)27-19-24-7-1-2-8-25(24)20-28(27)31(30)37;3-2(4,5)1(6)7/h1-2,7-12,19-21,33-35H,3-6,13-18,22,32H2;(H,6,7) |
| InChIKey | PGEPXMNVYDQDPX-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 142.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.69 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|