About N-[(2S,3R)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]pyridine-2-carboxamide
N-[(2S,3R)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]pyridine-2-carboxamide (PubChem CID 71459153) has the molecular formula C19H22N4O
and a molecular weight of 322.41 g/mol. Its IUPAC name is N-[(2S,3R)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]pyridine-2-carboxamide.
Molecular Properties
| Compound Name | N-[(2S,3R)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]pyridine-2-carboxamide |
| PubChem CID | 71459153 |
| Molecular Formula | C19H22N4O |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | N-[(2S,3R)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]pyridine-2-carboxamide |
| SMILES | O=C(N[C@@H]1C2CCN(CC2)[C@H]1Cc1cccnc1)c1ccccn1 |
| InChI | InChI=1S/C19H22N4O/c24-19(16-5-1-2-9-21-16)22-18-15-6-10-23(11-7-15)17(18)12-14-4-3-8-20-13-14/h1-5,8-9,13,15,17-18H,6-7,10-12H2,(H,22,24)/t17-,18+/m0/s1 |
| InChIKey | ZWCVNJVVVNDHTO-ZWKOTPCHSA-N |
| XLogP | 1.91 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(2S,3R)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S,3R)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]pyridine-2-carboxamide?
The IUPAC name of N-[(2S,3R)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]pyridine-2-carboxamide (CID 71459153) is N-[(2S,3R)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]pyridine-2-carboxamide.
What is the SMILES notation for N-[(2S,3R)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]pyridine-2-carboxamide?
The canonical SMILES for N-[(2S,3R)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]pyridine-2-carboxamide is O=C(N[C@@H]1C2CCN(CC2)[C@H]1Cc1cccnc1)c1ccccn1.
What is the InChIKey of N-[(2S,3R)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]pyridine-2-carboxamide?
The InChIKey is ZWCVNJVVVNDHTO-ZWKOTPCHSA-N. The full InChI is InChI=1S/C19H22N4O/c24-19(16-5-1-2-9-21-16)22-18-15-6-10-23(11-7-15)17(18)12-14-4-3-8-20-13-14/h1-5,8-9,13,15,17-18H,6-7,10-12H2,(H,22,24)/t17-,18+/m0/s1.
What are the key properties of N-[(2S,3R)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]pyridine-2-carboxamide?
N-[(2S,3R)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]pyridine-2-carboxamide has a molecular weight of 322.41 g/mol, XLogP of 1.91, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S,3R)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]pyridine-2-carboxamide is sourced from PubChem (CID 71459153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).