C24H19N7O — CID 71459244
N-benzhydryl-4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-amine (PubChem CID 71459244) has the molecular formula C24H19N7O and a molecular weight of 421.46 g/mol. Its IUPAC name is N-benzhydryl-4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-amine.
| Compound Name | N-benzhydryl-4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-amine |
|---|---|
| PubChem CID | 71459244 |
| Molecular Formula | C24H19N7O |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | N-benzhydryl-4-(furan-2-yl)-11-methyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-amine |
| SMILES | Cn1cc2c(nc(NC(c3ccccc3)c3ccccc3)n3nc(-c4ccco4)nc23)n1 |
| InChI | InChI=1S/C24H19N7O/c1-30-15-18-21(28-30)27-24(31-23(18)26-22(29-31)19-13-8-14-32-19)25-20(16-9-4-2-5-10-16)17-11-6-3-7-12-17/h2-15,20H,1H3,(H,25,27,28) |
| InChIKey | MKTDHKFRAQCBTM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 86.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |