C29H52N2O3+2 — CID 71459366
(3S,5S,8R,9S,10S,13S,14S,16S,17R)-10,13-dimethyl-3,16-bis(4-methylmorpholin-4-ium-4-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-ol (PubChem CID 71459366) has the molecular formula C29H52N2O3+2 and a molecular weight of 476.75 g/mol. Its IUPAC name is (3S,5S,8R,9S,10S,13S,14S,16S,17R)-10,13-dimethyl-3,16-bis(4-methylmorpholin-4-ium-4-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | (3S,5S,8R,9S,10S,13S,14S,16S,17R)-10,13-dimethyl-3,16-bis(4-methylmorpholin-4-ium-4-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 71459366 |
| Molecular Formula | C29H52N2O3+2 |
| Molecular Weight | 476.75 g/mol |
| Exact Mass | 476.40 |
| IUPAC Name | (3S,5S,8R,9S,10S,13S,14S,16S,17R)-10,13-dimethyl-3,16-bis(4-methylmorpholin-4-ium-4-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-ol |
| SMILES | C[C@]12CC[C@H]([N+]3(C)CCOCC3)C[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](O)[C@@H]([N+]3(C)CCOCC3)C[C@@H]12 |
| InChI | InChI=1S/C29H52N2O3/c1-28-9-7-22(30(3)11-15-33-16-12-30)19-21(28)5-6-23-24(28)8-10-29(2)25(23)20-26(27(29)32)31(4)13-17-34-18-14-31/h21-27,32H,5-20H2,1-4H3/q+2/t21-,22-,23+,24-,25-,26-,27-,28-,29-/m0/s1 |
| InChIKey | JMWFMMMTUGBVDU-INNIVPSYSA-N |
| XLogP | 3.69 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.75 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|