C25H31ClIN — CID 71459523
[4-(4-chlorophenyl)phenyl]methyl-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-dimethylazanium iodide (PubChem CID 71459523) has the molecular formula C25H31ClIN and a molecular weight of 507.89 g/mol. Its IUPAC name is [4-(4-chlorophenyl)phenyl]methyl-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-dimethylazanium iodide.
| Compound Name | [4-(4-chlorophenyl)phenyl]methyl-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-dimethylazanium iodide |
|---|---|
| PubChem CID | 71459523 |
| Molecular Formula | C25H31ClIN |
| Molecular Weight | 507.89 g/mol |
| Exact Mass | 507.12 |
| IUPAC Name | [4-(4-chlorophenyl)phenyl]methyl-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methyl]-dimethylazanium iodide |
| SMILES | CC1(C)[C@H]2CC=C(C[N+](C)(C)Cc3ccc(-c4ccc(Cl)cc4)cc3)[C@@H]1C2.[I-] |
| InChI | InChI=1S/C25H31ClN.HI/c1-25(2)22-12-9-21(24(25)15-22)17-27(3,4)16-18-5-7-19(8-6-18)20-10-13-23(26)14-11-20;/h5-11,13-14,22,24H,12,15-17H2,1-4H3;1H/q+1;/p-1/t22-,24-;/m0./s1 |
| InChIKey | PHDHKGLNVSRJCS-XYOGLKKJSA-M |
| XLogP | 3.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.89 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|