C20H34O2 — CID 71459530
(3R,3aS,5aS,8R,10aS,10bS)-3a-(hydroxymethyl)-5a,8-dimethyl-3-propan-2-yl-2,3,4,5,6,7,10a,10b-octahydro-1H-cyclohepta[e]inden-8-ol (PubChem CID 71459530) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is (3R,3aS,5aS,8R,10aS,10bS)-3a-(hydroxymethyl)-5a,8-dimethyl-3-propan-2-yl-2,3,4,5,6,7,10a,10b-octahydro-1H-cyclohepta[e]inden-8-ol.
| Compound Name | (3R,3aS,5aS,8R,10aS,10bS)-3a-(hydroxymethyl)-5a,8-dimethyl-3-propan-2-yl-2,3,4,5,6,7,10a,10b-octahydro-1H-cyclohepta[e]inden-8-ol |
|---|---|
| PubChem CID | 71459530 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | (3R,3aS,5aS,8R,10aS,10bS)-3a-(hydroxymethyl)-5a,8-dimethyl-3-propan-2-yl-2,3,4,5,6,7,10a,10b-octahydro-1H-cyclohepta[e]inden-8-ol |
| SMILES | CC(C)[C@H]1CC[C@H]2[C@@H]3C=C[C@](C)(O)CC[C@]3(C)CC[C@]12CO |
| InChI | InChI=1S/C20H34O2/c1-14(2)15-5-6-17-16-7-8-19(4,22)11-9-18(16,3)10-12-20(15,17)13-21/h7-8,14-17,21-22H,5-6,9-13H2,1-4H3/t15-,16+,17+,18-,19+,20+/m1/s1 |
| InChIKey | LFQXIQANLOWZLO-JIFZMYKYSA-N |
| XLogP | 4.16 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|