C21H26BrFN6O2 — CID 71459725
1-acetyl-N-[3-[[5-bromo-2-(3-fluoroanilino)pyrimidin-4-yl]amino]propyl]piperidine-4-carboxamide (PubChem CID 71459725) has the molecular formula C21H26BrFN6O2 and a molecular weight of 493.38 g/mol. Its IUPAC name is 1-acetyl-N-[3-[[5-bromo-2-(3-fluoroanilino)pyrimidin-4-yl]amino]propyl]piperidine-4-carboxamide.
| Compound Name | 1-acetyl-N-[3-[[5-bromo-2-(3-fluoroanilino)pyrimidin-4-yl]amino]propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 71459725 |
| Molecular Formula | C21H26BrFN6O2 |
| Molecular Weight | 493.38 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | 1-acetyl-N-[3-[[5-bromo-2-(3-fluoroanilino)pyrimidin-4-yl]amino]propyl]piperidine-4-carboxamide |
| SMILES | CC(=O)N1CCC(C(=O)NCCCNc2nc(Nc3cccc(F)c3)ncc2Br)CC1 |
| InChI | InChI=1S/C21H26BrFN6O2/c1-14(30)29-10-6-15(7-11-29)20(31)25-9-3-8-24-19-18(22)13-26-21(28-19)27-17-5-2-4-16(23)12-17/h2,4-5,12-13,15H,3,6-11H2,1H3,(H,25,31)(H2,24,26,27,28) |
| InChIKey | BMGILHOSVYBYGA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|