C40H38N12O2 — CID 71459755
3-[[4-[2-[[4-(3-cyanoanilino)-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]ethylamino]-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]benzonitrile (PubChem CID 71459755) has the molecular formula C40H38N12O2 and a molecular weight of 718.83 g/mol. Its IUPAC name is 3-[[4-[2-[[4-(3-cyanoanilino)-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]ethylamino]-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]benzonitrile.
| Compound Name | 3-[[4-[2-[[4-(3-cyanoanilino)-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]ethylamino]-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 71459755 |
| Molecular Formula | C40H38N12O2 |
| Molecular Weight | 718.83 g/mol |
| Exact Mass | 718.32 |
| IUPAC Name | 3-[[4-[2-[[4-(3-cyanoanilino)-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]ethylamino]-6-(2,4,6-trimethylphenoxy)-1,3,5-triazin-2-yl]amino]benzonitrile |
| SMILES | Cc1cc(C)c(Oc2nc(NCCNc3nc(Nc4cccc(C#N)c4)nc(Oc4c(C)cc(C)cc4C)n3)nc(Nc3cccc(C#N)c3)n2)c(C)c1 |
| InChI | InChI=1S/C40H38N12O2/c1-23-15-25(3)33(26(4)16-23)53-39-49-35(47-37(51-39)45-31-11-7-9-29(19-31)21-41)43-13-14-44-36-48-38(46-32-12-8-10-30(20-32)22-42)52-40(50-36)54-34-27(5)17-24(2)18-28(34)6/h7-12,15-20H,13-14H2,1-6H3,(H2,43,45,47,49,51)(H2,44,46,48,50,52) |
| InChIKey | OODXEKLLVOSDCE-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 191.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.83 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|