C39H36N12O2 — CID 71459775
4-[[4-[3-[[4-(4-cyanoanilino)-6-(2,6-dimethylphenoxy)-1,3,5-triazin-2-yl]amino]propylamino]-6-(2,6-dimethylphenoxy)-1,3,5-triazin-2-yl]amino]benzonitrile (PubChem CID 71459775) has the molecular formula C39H36N12O2 and a molecular weight of 704.80 g/mol. Its IUPAC name is 4-[[4-[3-[[4-(4-cyanoanilino)-6-(2,6-dimethylphenoxy)-1,3,5-triazin-2-yl]amino]propylamino]-6-(2,6-dimethylphenoxy)-1,3,5-triazin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-[3-[[4-(4-cyanoanilino)-6-(2,6-dimethylphenoxy)-1,3,5-triazin-2-yl]amino]propylamino]-6-(2,6-dimethylphenoxy)-1,3,5-triazin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 71459775 |
| Molecular Formula | C39H36N12O2 |
| Molecular Weight | 704.80 g/mol |
| Exact Mass | 704.31 |
| IUPAC Name | 4-[[4-[3-[[4-(4-cyanoanilino)-6-(2,6-dimethylphenoxy)-1,3,5-triazin-2-yl]amino]propylamino]-6-(2,6-dimethylphenoxy)-1,3,5-triazin-2-yl]amino]benzonitrile |
| SMILES | Cc1cccc(C)c1Oc1nc(NCCCNc2nc(Nc3ccc(C#N)cc3)nc(Oc3c(C)cccc3C)n2)nc(Nc2ccc(C#N)cc2)n1 |
| InChI | InChI=1S/C39H36N12O2/c1-24-8-5-9-25(2)32(24)52-38-48-34(46-36(50-38)44-30-16-12-28(22-40)13-17-30)42-20-7-21-43-35-47-37(45-31-18-14-29(23-41)15-19-31)51-39(49-35)53-33-26(3)10-6-11-27(33)4/h5-6,8-19H,7,20-21H2,1-4H3,(H2,42,44,46,48,50)(H2,43,45,47,49,51) |
| InChIKey | FKLVQWAMVYDWKR-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 191.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.80 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|