C23H15N3OS — CID 71459783
(2E)-2-(8-methoxy-2-naphthalen-2-ylpyrimido[2,1-b][1,3]benzothiazol-4-ylidene)acetonitrile (PubChem CID 71459783) has the molecular formula C23H15N3OS and a molecular weight of 381.46 g/mol. Its IUPAC name is (2E)-2-(8-methoxy-2-naphthalen-2-ylpyrimido[2,1-b][1,3]benzothiazol-4-ylidene)acetonitrile.
| Compound Name | (2E)-2-(8-methoxy-2-naphthalen-2-ylpyrimido[2,1-b][1,3]benzothiazol-4-ylidene)acetonitrile |
|---|---|
| PubChem CID | 71459783 |
| Molecular Formula | C23H15N3OS |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | (2E)-2-(8-methoxy-2-naphthalen-2-ylpyrimido[2,1-b][1,3]benzothiazol-4-ylidene)acetonitrile |
| SMILES | COc1ccc2c(c1)SC1=NC(c3ccc4ccccc4c3)=C/C(=C\C#N)N12 |
| InChI | InChI=1S/C23H15N3OS/c1-27-19-8-9-21-22(14-19)28-23-25-20(13-18(10-11-24)26(21)23)17-7-6-15-4-2-3-5-16(15)12-17/h2-10,12-14H,1H3/b18-10+ |
| InChIKey | CPSOIMPBKDWRHG-VCHYOVAHSA-N |
| XLogP | 5.58 |
| TPSA | 48.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|