C25H38O2 — CID 71459922
[(6aR,10aR)-3-(6,6-dimethylheptyl)-6,6-dimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-9-yl]methanol (PubChem CID 71459922) has the molecular formula C25H38O2 and a molecular weight of 370.58 g/mol. Its IUPAC name is [(6aR,10aR)-3-(6,6-dimethylheptyl)-6,6-dimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-9-yl]methanol.
| Compound Name | [(6aR,10aR)-3-(6,6-dimethylheptyl)-6,6-dimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-9-yl]methanol |
|---|---|
| PubChem CID | 71459922 |
| Molecular Formula | C25H38O2 |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.29 |
| IUPAC Name | [(6aR,10aR)-3-(6,6-dimethylheptyl)-6,6-dimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-9-yl]methanol |
| SMILES | CC(C)(C)CCCCCc1ccc2c(c1)OC(C)(C)[C@@H]1CC=C(CO)C[C@@H]21 |
| InChI | InChI=1S/C25H38O2/c1-24(2,3)14-8-6-7-9-18-10-12-20-21-15-19(17-26)11-13-22(21)25(4,5)27-23(20)16-18/h10-12,16,21-22,26H,6-9,13-15,17H2,1-5H3/t21-,22+/m0/s1 |
| InChIKey | MEPZCBIZPNCRSQ-FCHUYYIVSA-N |
| XLogP | 6.42 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|