C37H56BrNO5 — CID 71460043
didecyl-[(4,5-dihydroxy-7-methoxy-9,10-dioxoanthracen-2-yl)methyl]-methylazanium bromide (PubChem CID 71460043) has the molecular formula C37H56BrNO5 and a molecular weight of 674.76 g/mol. Its IUPAC name is didecyl-[(4,5-dihydroxy-7-methoxy-9,10-dioxoanthracen-2-yl)methyl]-methylazanium bromide.
| Compound Name | didecyl-[(4,5-dihydroxy-7-methoxy-9,10-dioxoanthracen-2-yl)methyl]-methylazanium bromide |
|---|---|
| PubChem CID | 71460043 |
| Molecular Formula | C37H56BrNO5 |
| Molecular Weight | 674.76 g/mol |
| Exact Mass | 673.33 |
| IUPAC Name | didecyl-[(4,5-dihydroxy-7-methoxy-9,10-dioxoanthracen-2-yl)methyl]-methylazanium bromide |
| SMILES | CCCCCCCCCC[N+](C)(CCCCCCCCCC)Cc1cc(O)c2c(c1)C(=O)c1cc(OC)cc(O)c1C2=O.[Br-] |
| InChI | InChI=1S/C37H55NO5.BrH/c1-5-7-9-11-13-15-17-19-21-38(3,22-20-18-16-14-12-10-8-6-2)27-28-23-30-34(32(39)24-28)37(42)35-31(36(30)41)25-29(43-4)26-33(35)40;/h23-26H,5-22,27H2,1-4H3,(H-,39,40,42);1H |
| InChIKey | CZLLPQKHSFNWGN-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.76 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|