C35H29ClN4O8 — CID 71460204
[4-[(6-chloropurin-9-yl)methyl]phenyl]methyl (7S,8R)-6-formyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydrobenzo[f][1,3]benzodioxole-7-carboxylate (PubChem CID 71460204) has the molecular formula C35H29ClN4O8 and a molecular weight of 669.09 g/mol. Its IUPAC name is [4-[(6-chloropurin-9-yl)methyl]phenyl]methyl (7S,8R)-6-formyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydrobenzo[f][1,3]benzodioxole-7-carboxylate.
| Compound Name | [4-[(6-chloropurin-9-yl)methyl]phenyl]methyl (7S,8R)-6-formyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydrobenzo[f][1,3]benzodioxole-7-carboxylate |
|---|---|
| PubChem CID | 71460204 |
| Molecular Formula | C35H29ClN4O8 |
| Molecular Weight | 669.09 g/mol |
| Exact Mass | 668.17 |
| IUPAC Name | [4-[(6-chloropurin-9-yl)methyl]phenyl]methyl (7S,8R)-6-formyl-8-(3,4,5-trimethoxyphenyl)-7,8-dihydrobenzo[f][1,3]benzodioxole-7-carboxylate |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3C=C(C=O)[C@H]2C(=O)OCc2ccc(Cn3cnc5c(Cl)ncnc53)cc2)OCO4)cc(OC)c1OC |
| InChI | InChI=1S/C35H29ClN4O8/c1-43-27-10-22(11-28(44-2)32(27)45-3)29-24-12-26-25(47-18-48-26)9-21(24)8-23(14-41)30(29)35(42)46-15-20-6-4-19(5-7-20)13-40-17-39-31-33(36)37-16-38-34(31)40/h4-12,14,16-17,29-30H,13,15,18H2,1-3H3/t29-,30-/m1/s1 |
| InChIKey | ANFLBQMMRYFDII-LOYHVIPDSA-N |
| XLogP | 5.37 |
| TPSA | 133.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.09 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|