About 4-[3-(2,4,6-trimethylphenoxy)anilino]benzonitrile
4-[3-(2,4,6-trimethylphenoxy)anilino]benzonitrile (PubChem CID 71460230) has the molecular formula C22H20N2O
and a molecular weight of 328.42 g/mol. Its IUPAC name is 4-[3-(2,4,6-trimethylphenoxy)anilino]benzonitrile.
Molecular Properties
| Compound Name | 4-[3-(2,4,6-trimethylphenoxy)anilino]benzonitrile |
| PubChem CID | 71460230 |
| Molecular Formula | C22H20N2O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 4-[3-(2,4,6-trimethylphenoxy)anilino]benzonitrile |
| SMILES | Cc1cc(C)c(Oc2cccc(Nc3ccc(C#N)cc3)c2)c(C)c1 |
| InChI | InChI=1S/C22H20N2O/c1-15-11-16(2)22(17(3)12-15)25-21-6-4-5-20(13-21)24-19-9-7-18(14-23)8-10-19/h4-13,24H,1-3H3 |
| InChIKey | QXCJABYMJOYMRO-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[3-(2,4,6-trimethylphenoxy)anilino]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(2,4,6-trimethylphenoxy)anilino]benzonitrile?
The IUPAC name of 4-[3-(2,4,6-trimethylphenoxy)anilino]benzonitrile (CID 71460230) is 4-[3-(2,4,6-trimethylphenoxy)anilino]benzonitrile.
What is the SMILES notation for 4-[3-(2,4,6-trimethylphenoxy)anilino]benzonitrile?
The canonical SMILES for 4-[3-(2,4,6-trimethylphenoxy)anilino]benzonitrile is Cc1cc(C)c(Oc2cccc(Nc3ccc(C#N)cc3)c2)c(C)c1.
What is the InChIKey of 4-[3-(2,4,6-trimethylphenoxy)anilino]benzonitrile?
The InChIKey is QXCJABYMJOYMRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N2O/c1-15-11-16(2)22(17(3)12-15)25-21-6-4-5-20(13-21)24-19-9-7-18(14-23)8-10-19/h4-13,24H,1-3H3.
What are the key properties of 4-[3-(2,4,6-trimethylphenoxy)anilino]benzonitrile?
4-[3-(2,4,6-trimethylphenoxy)anilino]benzonitrile has a molecular weight of 328.42 g/mol, XLogP of 6.02, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(2,4,6-trimethylphenoxy)anilino]benzonitrile is sourced from PubChem (CID 71460230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).