C25H20ClF8N3O2 — CID 71460261
1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-(3,3,3-trifluoropropyl)urea (PubChem CID 71460261) has the molecular formula C25H20ClF8N3O2 and a molecular weight of 581.89 g/mol. Its IUPAC name is 1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-(3,3,3-trifluoropropyl)urea.
| Compound Name | 1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-(3,3,3-trifluoropropyl)urea |
|---|---|
| PubChem CID | 71460261 |
| Molecular Formula | C25H20ClF8N3O2 |
| Molecular Weight | 581.89 g/mol |
| Exact Mass | 581.11 |
| IUPAC Name | 1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-fluoro-5-(1,1,2,2-tetrafluoroethoxy)phenyl]-2-phenylethyl]-3-(3,3,3-trifluoropropyl)urea |
| SMILES | O=C(NCCC(F)(F)F)N[C@@](Cc1ccccc1)(c1cc(F)cc(OC(F)(F)C(F)F)c1)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C25H20ClF8N3O2/c26-17-6-7-20(36-14-17)23(13-15-4-2-1-3-5-15,37-22(38)35-9-8-24(30,31)32)16-10-18(27)12-19(11-16)39-25(33,34)21(28)29/h1-7,10-12,14,21H,8-9,13H2,(H2,35,37,38)/t23-/m0/s1 |
| InChIKey | NORZGEJMRUDBDL-QHCPKHFHSA-N |
| XLogP | 6.85 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.89 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|