C18H21NO2 — CID 71460292
(1S,2S)-2-morpholin-4-yl-1,2-diphenylethanol (PubChem CID 71460292) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is (1S,2S)-2-morpholin-4-yl-1,2-diphenylethanol.
| Compound Name | (1S,2S)-2-morpholin-4-yl-1,2-diphenylethanol |
|---|---|
| PubChem CID | 71460292 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (1S,2S)-2-morpholin-4-yl-1,2-diphenylethanol |
| SMILES | O[C@@H](c1ccccc1)[C@H](c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C18H21NO2/c20-18(16-9-5-2-6-10-16)17(15-7-3-1-4-8-15)19-11-13-21-14-12-19/h1-10,17-18,20H,11-14H2/t17-,18-/m0/s1 |
| InChIKey | BQRBHUBJRJBXPF-ROUUACIJSA-N |
| XLogP | 2.79 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |