C16H13N5O2S — CID 71460341
N-(3,5-dimethoxyphenyl)-8-thia-3,5,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-6-amine (PubChem CID 71460341) has the molecular formula C16H13N5O2S and a molecular weight of 339.38 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-8-thia-3,5,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-6-amine.
| Compound Name | N-(3,5-dimethoxyphenyl)-8-thia-3,5,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-6-amine |
|---|---|
| PubChem CID | 71460341 |
| Molecular Formula | C16H13N5O2S |
| Molecular Weight | 339.38 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-8-thia-3,5,10,13-tetrazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-6-amine |
| SMILES | COc1cc(Nc2ncnc3c2sc2nccnc23)cc(OC)c1 |
| InChI | InChI=1S/C16H13N5O2S/c1-22-10-5-9(6-11(7-10)23-2)21-15-14-12(19-8-20-15)13-16(24-14)18-4-3-17-13/h3-8H,1-2H3,(H,19,20,21) |
| InChIKey | YJUARYWBIVZITR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |