About (2S)-6-amino-2-[3-(2,3-diaminopropanoylamino)propanoylamino]hexanamide
(2S)-6-amino-2-[3-(2,3-diaminopropanoylamino)propanoylamino]hexanamide (PubChem CID 71460434) has the molecular formula C12H26N6O3
and a molecular weight of 302.38 g/mol. Its IUPAC name is (2S)-6-amino-2-[3-(2,3-diaminopropanoylamino)propanoylamino]hexanamide.
Molecular Properties
| Compound Name | (2S)-6-amino-2-[3-(2,3-diaminopropanoylamino)propanoylamino]hexanamide |
| PubChem CID | 71460434 |
| Molecular Formula | C12H26N6O3 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | (2S)-6-amino-2-[3-(2,3-diaminopropanoylamino)propanoylamino]hexanamide |
| SMILES | NCCCC[C@H](NC(=O)CCNC(=O)C(N)CN)C(N)=O |
| InChI | InChI=1S/C12H26N6O3/c13-5-2-1-3-9(11(16)20)18-10(19)4-6-17-12(21)8(15)7-14/h8-9H,1-7,13-15H2,(H2,16,20)(H,17,21)(H,18,19)/t8?,9-/m0/s1 |
| InChIKey | CDCBXNRGYNGHAT-GKAPJAKFSA-N |
| XLogP | -3.12 |
| TPSA | 179.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | -3.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-6-amino-2-[3-(2,3-diaminopropanoylamino)propanoylamino]hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-6-amino-2-[3-(2,3-diaminopropanoylamino)propanoylamino]hexanamide?
The IUPAC name of (2S)-6-amino-2-[3-(2,3-diaminopropanoylamino)propanoylamino]hexanamide (CID 71460434) is (2S)-6-amino-2-[3-(2,3-diaminopropanoylamino)propanoylamino]hexanamide.
What is the SMILES notation for (2S)-6-amino-2-[3-(2,3-diaminopropanoylamino)propanoylamino]hexanamide?
The canonical SMILES for (2S)-6-amino-2-[3-(2,3-diaminopropanoylamino)propanoylamino]hexanamide is NCCCC[C@H](NC(=O)CCNC(=O)C(N)CN)C(N)=O.
What is the InChIKey of (2S)-6-amino-2-[3-(2,3-diaminopropanoylamino)propanoylamino]hexanamide?
The InChIKey is CDCBXNRGYNGHAT-GKAPJAKFSA-N. The full InChI is InChI=1S/C12H26N6O3/c13-5-2-1-3-9(11(16)20)18-10(19)4-6-17-12(21)8(15)7-14/h8-9H,1-7,13-15H2,(H2,16,20)(H,17,21)(H,18,19)/t8?,9-/m0/s1.
What are the key properties of (2S)-6-amino-2-[3-(2,3-diaminopropanoylamino)propanoylamino]hexanamide?
(2S)-6-amino-2-[3-(2,3-diaminopropanoylamino)propanoylamino]hexanamide has a molecular weight of 302.38 g/mol, XLogP of -3.12, 11 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-6-amino-2-[3-(2,3-diaminopropanoylamino)propanoylamino]hexanamide is sourced from PubChem (CID 71460434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).