C28H30N2O — CID 71460471
(E,2R,3S,6S)-3-methyl-2,6-diphenyl-N-phenylmethoxy-1-prop-2-enylpiperidin-4-imine (PubChem CID 71460471) has the molecular formula C28H30N2O and a molecular weight of 410.56 g/mol. Its IUPAC name is (E,2R,3S,6S)-3-methyl-2,6-diphenyl-N-phenylmethoxy-1-prop-2-enylpiperidin-4-imine.
| Compound Name | (E,2R,3S,6S)-3-methyl-2,6-diphenyl-N-phenylmethoxy-1-prop-2-enylpiperidin-4-imine |
|---|---|
| PubChem CID | 71460471 |
| Molecular Formula | C28H30N2O |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | (E,2R,3S,6S)-3-methyl-2,6-diphenyl-N-phenylmethoxy-1-prop-2-enylpiperidin-4-imine |
| SMILES | C=CCN1[C@H](c2ccccc2)C/C(=N\OCc2ccccc2)[C@@H](C)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C28H30N2O/c1-3-19-30-27(24-15-9-5-10-16-24)20-26(29-31-21-23-13-7-4-8-14-23)22(2)28(30)25-17-11-6-12-18-25/h3-18,22,27-28H,1,19-21H2,2H3/b29-26+/t22-,27+,28-/m1/s1 |
| InChIKey | YHHOJYNEDNTXPM-MVMYERTDSA-N |
| XLogP | 6.57 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|